C10H14N2 — CID 83970812
1-ethyl-1,2,3,4-tetrahydro-2,7-naphthyridine (PubChem CID 83970812) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-ethyl-1,2,3,4-tetrahydro-2,7-naphthyridine.
| Compound Name | 1-ethyl-1,2,3,4-tetrahydro-2,7-naphthyridine |
|---|---|
| PubChem CID | 83970812 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-ethyl-1,2,3,4-tetrahydro-2,7-naphthyridine |
| SMILES | CCC1NCCc2ccncc21 |
| InChI | InChI=1S/C10H14N2/c1-2-10-9-7-11-5-3-8(9)4-6-12-10/h3,5,7,10,12H,2,4,6H2,1H3 |
| InChIKey | MLYOUEXWJAFKSW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |