C13H15N — CID 118274759
(1R)-1-but-2-ynyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 118274759) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is (1R)-1-but-2-ynyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R)-1-but-2-ynyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 118274759 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (1R)-1-but-2-ynyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC#CC[C@H]1NCCc2ccccc21 |
| InChI | InChI=1S/C13H15N/c1-2-3-8-13-12-7-5-4-6-11(12)9-10-14-13/h4-7,13-14H,8-10H2,1H3/t13-/m1/s1 |
| InChIKey | JZKKOFCCHJVCNB-CYBMUJFWSA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|