C14H15NO — CID 83175633
1-(furan-2-ylmethyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 83175633) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-(furan-2-ylmethyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 83175633 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1coc(CC2NCCc3ccccc32)c1 |
| InChI | InChI=1S/C14H15NO/c1-2-6-13-11(4-1)7-8-15-14(13)10-12-5-3-9-16-12/h1-6,9,14-15H,7-8,10H2 |
| InChIKey | GAPCLRRXGDHVFW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |