C16H18N+ — CID 7009453
2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylazanium (PubChem CID 7009453) has the molecular formula C16H18N+ and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylazanium.
| Compound Name | 2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylazanium |
|---|---|
| PubChem CID | 7009453 |
| Molecular Formula | C16H18N+ |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethylazanium |
| SMILES | [NH3+]CC1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C16H17N/c17-11-16-14-7-3-1-5-12(14)9-10-13-6-2-4-8-15(13)16/h1-8,16H,9-11,17H2/p+1 |
| InChIKey | YJCNPACNIAQKNY-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |