C19H24N2 — CID 23791959
N'-methyl-N'-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)ethane-1,2-diamine (PubChem CID 23791959) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is N'-methyl-N'-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 23791959 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N'-methyl-N'-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)ethane-1,2-diamine |
| SMILES | CN(CCN)CC1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C19H24N2/c1-21(13-12-20)14-19-17-8-4-2-6-15(17)10-11-16-7-3-5-9-18(16)19/h2-9,19H,10-14,20H2,1H3 |
| InChIKey | KCKNIWWYDMYGFH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |