C19H20O2 — CID 70037925
1-(2,3-dihydro-1H-inden-1-yloxymethoxy)-2,3-dihydro-1H-indene (PubChem CID 70037925) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yloxymethoxy)-2,3-dihydro-1H-indene.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yloxymethoxy)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 70037925 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yloxymethoxy)-2,3-dihydro-1H-indene |
| SMILES | c1ccc2c(c1)CCC2OCOC1CCc2ccccc21 |
| InChI | InChI=1S/C19H20O2/c1-3-7-16-14(5-1)9-11-18(16)20-13-21-19-12-10-15-6-2-4-8-17(15)19/h1-8,18-19H,9-13H2 |
| InChIKey | ILTBKNZLDNBIAA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|