C11H11ClO3 — CID 121218784
chloromethyl [(1R)-2,3-dihydro-1H-inden-1-yl] carbonate (PubChem CID 121218784) has the molecular formula C11H11ClO3 and a molecular weight of 226.66 g/mol. Its IUPAC name is chloromethyl [(1R)-2,3-dihydro-1H-inden-1-yl] carbonate.
| Compound Name | chloromethyl [(1R)-2,3-dihydro-1H-inden-1-yl] carbonate |
|---|---|
| PubChem CID | 121218784 |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | chloromethyl [(1R)-2,3-dihydro-1H-inden-1-yl] carbonate |
| SMILES | O=C(OCCl)O[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C11H11ClO3/c12-7-14-11(13)15-10-6-5-8-3-1-2-4-9(8)10/h1-4,10H,5-7H2/t10-/m1/s1 |
| InChIKey | KYYMJEPYOQURGW-SNVBAGLBSA-N |
| XLogP | 3.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|