C17H17NO3 — CID 102129679
2,3-dihydro-1H-inden-1-yl N-(4-methoxyphenyl)carbamate (PubChem CID 102129679) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-yl N-(4-methoxyphenyl)carbamate.
| Compound Name | 2,3-dihydro-1H-inden-1-yl N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 102129679 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-yl N-(4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OC2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H17NO3/c1-20-14-9-7-13(8-10-14)18-17(19)21-16-11-6-12-4-2-3-5-15(12)16/h2-5,7-10,16H,6,11H2,1H3,(H,18,19) |
| InChIKey | MOSSWYYLQIFSMK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |