C28H32N3O4+ — CID 2487797
bis[2-(4-methoxyanilino)-2-oxoethyl]-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium (PubChem CID 2487797) has the molecular formula C28H32N3O4+ and a molecular weight of 474.58 g/mol. Its IUPAC name is bis[2-(4-methoxyanilino)-2-oxoethyl]-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium.
| Compound Name | bis[2-(4-methoxyanilino)-2-oxoethyl]-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium |
|---|---|
| PubChem CID | 2487797 |
| Molecular Formula | C28H32N3O4+ |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | bis[2-(4-methoxyanilino)-2-oxoethyl]-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]azanium |
| SMILES | COc1ccc(NC(=O)C[NH+](CC(=O)Nc2ccc(OC)cc2)[C@@H]2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C28H31N3O4/c1-34-23-14-10-21(11-15-23)29-27(32)18-31(26-9-5-7-20-6-3-4-8-25(20)26)19-28(33)30-22-12-16-24(35-2)17-13-22/h3-4,6,8,10-17,26H,5,7,9,18-19H2,1-2H3,(H,29,32)(H,30,33)/p+1/t26-/m1/s1 |
| InChIKey | RDPUCMKIBUQIRB-AREMUKBSSA-O |
| XLogP | 3.24 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |