C19H20O2 — CID 65446449
1-(2,3-dihydro-1H-inden-1-yl)-3-(4-methoxyphenyl)propan-1-one (PubChem CID 65446449) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)-3-(4-methoxyphenyl)propan-1-one.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 65446449 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(CCC(=O)C2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C19H20O2/c1-21-16-10-6-14(7-11-16)8-13-19(20)18-12-9-15-4-2-3-5-17(15)18/h2-7,10-11,18H,8-9,12-13H2,1H3 |
| InChIKey | ZLGGXZYOHKGYSE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |