C17H18O — CID 101467069
1-[(4-methoxyphenyl)methyl]-2,3-dihydro-1H-indene (PubChem CID 101467069) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-2,3-dihydro-1H-indene.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 101467069 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-2,3-dihydro-1H-indene |
| SMILES | COc1ccc(CC2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H18O/c1-18-16-10-6-13(7-11-16)12-15-9-8-14-4-2-3-5-17(14)15/h2-7,10-11,15H,8-9,12H2,1H3 |
| InChIKey | SKKOGRQZKLNSHC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |