C13H16O2 — CID 11790327
2-[(4-methoxyphenyl)methyl]cyclopentan-1-one (PubChem CID 11790327) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]cyclopentan-1-one.
| Compound Name | 2-[(4-methoxyphenyl)methyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 11790327 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]cyclopentan-1-one |
| SMILES | COc1ccc(CC2CCCC2=O)cc1 |
| InChI | InChI=1S/C13H16O2/c1-15-12-7-5-10(6-8-12)9-11-3-2-4-13(11)14/h5-8,11H,2-4,9H2,1H3 |
| InChIKey | ILOBDFZALNUIDL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |