C22H28O3 — CID 145337501
1-methoxy-3-methylbenzene;2-[(3-methoxyphenyl)methyl]cyclohexan-1-one (PubChem CID 145337501) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 1-methoxy-3-methylbenzene;2-[(3-methoxyphenyl)methyl]cyclohexan-1-one.
| Compound Name | 1-methoxy-3-methylbenzene;2-[(3-methoxyphenyl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 145337501 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-methoxy-3-methylbenzene;2-[(3-methoxyphenyl)methyl]cyclohexan-1-one |
| SMILES | COc1cccc(C)c1.COc1cccc(CC2CCCCC2=O)c1 |
| InChI | InChI=1S/C14H18O2.C8H10O/c1-16-13-7-4-5-11(10-13)9-12-6-2-3-8-14(12)15;1-7-4-3-5-8(6-7)9-2/h4-5,7,10,12H,2-3,6,8-9H2,1H3;3-6H,1-2H3 |
| InChIKey | YGYIWQKUPFNJEW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |