C22H26O3 — CID 101474976
(2R,3aR,5R,6aR)-5-[(3-methoxyphenyl)methyl]-2-[(4-methylphenyl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 101474976) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2R,3aR,5R,6aR)-5-[(3-methoxyphenyl)methyl]-2-[(4-methylphenyl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (2R,3aR,5R,6aR)-5-[(3-methoxyphenyl)methyl]-2-[(4-methylphenyl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 101474976 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (2R,3aR,5R,6aR)-5-[(3-methoxyphenyl)methyl]-2-[(4-methylphenyl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | COc1cccc(C[C@@H]2C[C@H]3O[C@H](Cc4ccc(C)cc4)C[C@H]3O2)c1 |
| InChI | InChI=1S/C22H26O3/c1-15-6-8-16(9-7-15)10-19-13-21-22(24-19)14-20(25-21)12-17-4-3-5-18(11-17)23-2/h3-9,11,19-22H,10,12-14H2,1-2H3/t19-,20-,21-,22-/m1/s1 |
| InChIKey | XKNNCZPWTFHDMB-GXRSIYKFSA-N |
| XLogP | 4.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |