C19H26O3 — CID 125180728
(4aR,5R,8aR)-5-hydroxy-5-[2-(3-methoxyphenyl)ethyl]-2,3,4,4a,6,7,8,8a-octahydronaphthalen-1-one (PubChem CID 125180728) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (4aR,5R,8aR)-5-hydroxy-5-[2-(3-methoxyphenyl)ethyl]-2,3,4,4a,6,7,8,8a-octahydronaphthalen-1-one.
| Compound Name | (4aR,5R,8aR)-5-hydroxy-5-[2-(3-methoxyphenyl)ethyl]-2,3,4,4a,6,7,8,8a-octahydronaphthalen-1-one |
|---|---|
| PubChem CID | 125180728 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (4aR,5R,8aR)-5-hydroxy-5-[2-(3-methoxyphenyl)ethyl]-2,3,4,4a,6,7,8,8a-octahydronaphthalen-1-one |
| SMILES | COc1cccc(CC[C@]2(O)CCC[C@H]3C(=O)CCC[C@H]32)c1 |
| InChI | InChI=1S/C19H26O3/c1-22-15-6-2-5-14(13-15)10-12-19(21)11-4-7-16-17(19)8-3-9-18(16)20/h2,5-6,13,16-17,21H,3-4,7-12H2,1H3/t16-,17-,19-/m1/s1 |
| InChIKey | QLIZPHPPXPDWAL-ZHALLVOQSA-N |
| XLogP | 3.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |