C28H34O6 — CID 16728834
6-cyclopentyl-6-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3-methoxyphenyl)methyl]oxane-2,4-dione (PubChem CID 16728834) has the molecular formula C28H34O6 and a molecular weight of 466.57 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3-methoxyphenyl)methyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3-methoxyphenyl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 16728834 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 6-cyclopentyl-6-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(3-methoxyphenyl)methyl]oxane-2,4-dione |
| SMILES | COc1cccc(CC2C(=O)CC(CCc3ccc(OC)c(OC)c3)(C3CCCC3)OC2=O)c1 |
| InChI | InChI=1S/C28H34O6/c1-31-22-10-6-7-20(15-22)16-23-24(29)18-28(34-27(23)30,21-8-4-5-9-21)14-13-19-11-12-25(32-2)26(17-19)33-3/h6-7,10-12,15,17,21,23H,4-5,8-9,13-14,16,18H2,1-3H3 |
| InChIKey | YCQXZNYOARBYLL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|