C19H24O5 — CID 54689531
2-cyclopentyl-4-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-3H-pyran-6-one (PubChem CID 54689531) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-cyclopentyl-4-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-3H-pyran-6-one.
| Compound Name | 2-cyclopentyl-4-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-3H-pyran-6-one |
|---|---|
| PubChem CID | 54689531 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-cyclopentyl-4-hydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-3H-pyran-6-one |
| SMILES | COc1cc(CCC2(C3CCCC3)CC(O)=CC(=O)O2)ccc1O |
| InChI | InChI=1S/C19H24O5/c1-23-17-10-13(6-7-16(17)21)8-9-19(14-4-2-3-5-14)12-15(20)11-18(22)24-19/h6-7,10-11,14,20-21H,2-5,8-9,12H2,1H3 |
| InChIKey | UDQVQKTYFSDDOR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |