C21H28O5 — CID 68865846
6-cyclopentyl-6-[2-[3-(1-hydroxyethyl)-4-methoxyphenyl]ethyl]oxane-2,4-dione (PubChem CID 68865846) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-[3-(1-hydroxyethyl)-4-methoxyphenyl]ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-[3-(1-hydroxyethyl)-4-methoxyphenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 68865846 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 6-cyclopentyl-6-[2-[3-(1-hydroxyethyl)-4-methoxyphenyl]ethyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)CC(=O)O2)cc1C(C)O |
| InChI | InChI=1S/C21H28O5/c1-14(22)18-11-15(7-8-19(18)25-2)9-10-21(16-5-3-4-6-16)13-17(23)12-20(24)26-21/h7-8,11,14,16,22H,3-6,9-10,12-13H2,1-2H3 |
| InChIKey | PNGQDRVXMCOGNB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|