C23H28FNO3 — CID 142935262
2-[4-[2-(2-cyclohexyl-4,6-dioxooxan-2-yl)ethyl]-2-fluorophenyl]-2-methylpropanenitrile (PubChem CID 142935262) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is 2-[4-[2-(2-cyclohexyl-4,6-dioxooxan-2-yl)ethyl]-2-fluorophenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[2-(2-cyclohexyl-4,6-dioxooxan-2-yl)ethyl]-2-fluorophenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 142935262 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 2-[4-[2-(2-cyclohexyl-4,6-dioxooxan-2-yl)ethyl]-2-fluorophenyl]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)c1ccc(CCC2(C3CCCCC3)CC(=O)CC(=O)O2)cc1F |
| InChI | InChI=1S/C23H28FNO3/c1-22(2,15-25)19-9-8-16(12-20(19)24)10-11-23(17-6-4-3-5-7-17)14-18(26)13-21(27)28-23/h8-9,12,17H,3-7,10-11,13-14H2,1-2H3 |
| InChIKey | KWOYXZOKWSFHDB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|