C18H21FO3 — CID 141134314
(6R)-6-cyclopentyl-6-[2-(3-fluorophenyl)ethyl]oxane-2,4-dione (PubChem CID 141134314) has the molecular formula C18H21FO3 and a molecular weight of 304.36 g/mol. Its IUPAC name is (6R)-6-cyclopentyl-6-[2-(3-fluorophenyl)ethyl]oxane-2,4-dione.
| Compound Name | (6R)-6-cyclopentyl-6-[2-(3-fluorophenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 141134314 |
| Molecular Formula | C18H21FO3 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (6R)-6-cyclopentyl-6-[2-(3-fluorophenyl)ethyl]oxane-2,4-dione |
| SMILES | O=C1CC(=O)O[C@@](CCc2cccc(F)c2)(C2CCCC2)C1 |
| InChI | InChI=1S/C18H21FO3/c19-15-7-3-4-13(10-15)8-9-18(14-5-1-2-6-14)12-16(20)11-17(21)22-18/h3-4,7,10,14H,1-2,5-6,8-9,11-12H2/t18-/m1/s1 |
| InChIKey | BMCQPXGKRQUSOC-GOSISDBHSA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|