C22H28FNO3 — CID 142935302
4-[2-(2-cyclopentyl-6-methylidene-4-oxooxan-2-yl)ethyl]-N-ethyl-2-fluorobenzamide (PubChem CID 142935302) has the molecular formula C22H28FNO3 and a molecular weight of 373.47 g/mol. Its IUPAC name is 4-[2-(2-cyclopentyl-6-methylidene-4-oxooxan-2-yl)ethyl]-N-ethyl-2-fluorobenzamide.
| Compound Name | 4-[2-(2-cyclopentyl-6-methylidene-4-oxooxan-2-yl)ethyl]-N-ethyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 142935302 |
| Molecular Formula | C22H28FNO3 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 4-[2-(2-cyclopentyl-6-methylidene-4-oxooxan-2-yl)ethyl]-N-ethyl-2-fluorobenzamide |
| SMILES | C=C1CC(=O)CC(CCc2ccc(C(=O)NCC)c(F)c2)(C2CCCC2)O1 |
| InChI | InChI=1S/C22H28FNO3/c1-3-24-21(26)19-9-8-16(13-20(19)23)10-11-22(17-6-4-5-7-17)14-18(25)12-15(2)27-22/h8-9,13,17H,2-7,10-12,14H2,1H3,(H,24,26) |
| InChIKey | ZXUHTGVGIPXXOB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |