C22H29FO4 — CID 58762679
6-cyclopentyl-6-[2-[3-fluoro-4-(1-hydroxy-2-methylpropan-2-yl)phenyl]ethyl]oxane-2,4-dione (PubChem CID 58762679) has the molecular formula C22H29FO4 and a molecular weight of 376.47 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-[3-fluoro-4-(1-hydroxy-2-methylpropan-2-yl)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-[3-fluoro-4-(1-hydroxy-2-methylpropan-2-yl)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 58762679 |
| Molecular Formula | C22H29FO4 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 6-cyclopentyl-6-[2-[3-fluoro-4-(1-hydroxy-2-methylpropan-2-yl)phenyl]ethyl]oxane-2,4-dione |
| SMILES | CC(C)(CO)c1ccc(CCC2(C3CCCC3)CC(=O)CC(=O)O2)cc1F |
| InChI | InChI=1S/C22H29FO4/c1-21(2,14-24)18-8-7-15(11-19(18)23)9-10-22(16-5-3-4-6-16)13-17(25)12-20(26)27-22/h7-8,11,16,24H,3-6,9-10,12-14H2,1-2H3 |
| InChIKey | RFUGZGPDLDRXSE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|