C20H23F3O4 — CID 58762700
6-cyclopentyl-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione (PubChem CID 58762700) has the molecular formula C20H23F3O4 and a molecular weight of 384.39 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 58762700 |
| Molecular Formula | C20H23F3O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 6-cyclopentyl-6-[2-[4-hydroxy-3-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione |
| SMILES | O=C1CC(=O)OC(CCc2ccc(O)c(CC(F)(F)F)c2)(C2CCCC2)C1 |
| InChI | InChI=1S/C20H23F3O4/c21-20(22,23)11-14-9-13(5-6-17(14)25)7-8-19(15-3-1-2-4-15)12-16(24)10-18(26)27-19/h5-6,9,15,25H,1-4,7-8,10-12H2 |
| InChIKey | CWFBIGBXBNCJIU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|