C25H30F3NO3 — CID 58764147
2-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-(trifluoromethyl)phenyl]-2-ethylbutanenitrile (PubChem CID 58764147) has the molecular formula C25H30F3NO3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-(trifluoromethyl)phenyl]-2-ethylbutanenitrile.
| Compound Name | 2-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-(trifluoromethyl)phenyl]-2-ethylbutanenitrile |
|---|---|
| PubChem CID | 58764147 |
| Molecular Formula | C25H30F3NO3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-[4-[2-(2-cyclopentyl-4,6-dioxooxan-2-yl)ethyl]-2-(trifluoromethyl)phenyl]-2-ethylbutanenitrile |
| SMILES | CCC(C#N)(CC)c1ccc(CCC2(C3CCCC3)CC(=O)CC(=O)O2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H30F3NO3/c1-3-23(4-2,16-29)20-10-9-17(13-21(20)25(26,27)28)11-12-24(18-7-5-6-8-18)15-19(30)14-22(31)32-24/h9-10,13,18H,3-8,11-12,14-15H2,1-2H3 |
| InChIKey | CILXCRGKNPXXDQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|