C30H31NO4 — CID 10288650
6-cyclopentyl-6-[2-(3-hydroxyphenyl)ethyl]-3-(N-phenylanilino)oxane-2,4-dione (PubChem CID 10288650) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-(3-hydroxyphenyl)ethyl]-3-(N-phenylanilino)oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-(3-hydroxyphenyl)ethyl]-3-(N-phenylanilino)oxane-2,4-dione |
|---|---|
| PubChem CID | 10288650 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 6-cyclopentyl-6-[2-(3-hydroxyphenyl)ethyl]-3-(N-phenylanilino)oxane-2,4-dione |
| SMILES | O=C1CC(CCc2cccc(O)c2)(C2CCCC2)OC(=O)C1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H31NO4/c32-26-17-9-10-22(20-26)18-19-30(23-11-7-8-12-23)21-27(33)28(29(34)35-30)31(24-13-3-1-4-14-24)25-15-5-2-6-16-25/h1-6,9-10,13-17,20,23,28,32H,7-8,11-12,18-19,21H2 |
| InChIKey | KPDSPDABLLMYCC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|