C27H33NO4 — CID 10238232
6-cyclopentyl-6-[2-(4-hydroxyphenyl)ethyl]-3-(N-propylanilino)oxane-2,4-dione (PubChem CID 10238232) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-(4-hydroxyphenyl)ethyl]-3-(N-propylanilino)oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-(4-hydroxyphenyl)ethyl]-3-(N-propylanilino)oxane-2,4-dione |
|---|---|
| PubChem CID | 10238232 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 6-cyclopentyl-6-[2-(4-hydroxyphenyl)ethyl]-3-(N-propylanilino)oxane-2,4-dione |
| SMILES | CCCN(c1ccccc1)C1C(=O)CC(CCc2ccc(O)cc2)(C2CCCC2)OC1=O |
| InChI | InChI=1S/C27H33NO4/c1-2-18-28(22-10-4-3-5-11-22)25-24(30)19-27(32-26(25)31,21-8-6-7-9-21)17-16-20-12-14-23(29)15-13-20/h3-5,10-15,21,25,29H,2,6-9,16-19H2,1H3 |
| InChIKey | VEELRSHPKOSDRQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|