C29H34N2O5S2 — CID 10218381
N-[3-[[2,4-dioxo-6-(2-phenylethyl)-6-propan-2-yloxan-3-yl]-propylamino]phenyl]thiophene-2-sulfonamide (PubChem CID 10218381) has the molecular formula C29H34N2O5S2 and a molecular weight of 554.73 g/mol. Its IUPAC name is N-[3-[[2,4-dioxo-6-(2-phenylethyl)-6-propan-2-yloxan-3-yl]-propylamino]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[[2,4-dioxo-6-(2-phenylethyl)-6-propan-2-yloxan-3-yl]-propylamino]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 10218381 |
| Molecular Formula | C29H34N2O5S2 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | N-[3-[[2,4-dioxo-6-(2-phenylethyl)-6-propan-2-yloxan-3-yl]-propylamino]phenyl]thiophene-2-sulfonamide |
| SMILES | CCCN(c1cccc(NS(=O)(=O)c2cccs2)c1)C1C(=O)CC(CCc2ccccc2)(C(C)C)OC1=O |
| InChI | InChI=1S/C29H34N2O5S2/c1-4-17-31(24-13-8-12-23(19-24)30-38(34,35)26-14-9-18-37-26)27-25(32)20-29(21(2)3,36-28(27)33)16-15-22-10-6-5-7-11-22/h5-14,18-19,21,27,30H,4,15-17,20H2,1-3H3 |
| InChIKey | BYOHEZJGBTWMSO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|