C28H38N2O4S2 — CID 90770746
N-[3-[(6,6-dicyclopentyl-4-oxooxan-3-yl)-propylamino]phenyl]thiophene-2-sulfonamide (PubChem CID 90770746) has the molecular formula C28H38N2O4S2 and a molecular weight of 530.76 g/mol. Its IUPAC name is N-[3-[(6,6-dicyclopentyl-4-oxooxan-3-yl)-propylamino]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[(6,6-dicyclopentyl-4-oxooxan-3-yl)-propylamino]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90770746 |
| Molecular Formula | C28H38N2O4S2 |
| Molecular Weight | 530.76 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | N-[3-[(6,6-dicyclopentyl-4-oxooxan-3-yl)-propylamino]phenyl]thiophene-2-sulfonamide |
| SMILES | CCCN(c1cccc(NS(=O)(=O)c2cccs2)c1)C1COC(C2CCCC2)(C2CCCC2)CC1=O |
| InChI | InChI=1S/C28H38N2O4S2/c1-2-16-30(24-14-7-13-23(18-24)29-36(32,33)27-15-8-17-35-27)25-20-34-28(19-26(25)31,21-9-3-4-10-21)22-11-5-6-12-22/h7-8,13-15,17-18,21-22,25,29H,2-6,9-12,16,19-20H2,1H3 |
| InChIKey | TZCWXPCVXOJRKD-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.76 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |