C15H17NO4S3 — CID 38945179
N-(3-cyclopentylsulfonylphenyl)thiophene-2-sulfonamide (PubChem CID 38945179) has the molecular formula C15H17NO4S3 and a molecular weight of 371.51 g/mol. Its IUPAC name is N-(3-cyclopentylsulfonylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(3-cyclopentylsulfonylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 38945179 |
| Molecular Formula | C15H17NO4S3 |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-(3-cyclopentylsulfonylphenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(S(=O)(=O)C2CCCC2)c1)c1cccs1 |
| InChI | InChI=1S/C15H17NO4S3/c17-22(18,13-6-1-2-7-13)14-8-3-5-12(11-14)16-23(19,20)15-9-4-10-21-15/h3-5,8-11,13,16H,1-2,6-7H2 |
| InChIKey | DYCWKIHXDZRLNB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |