C20H25NO4S2 — CID 38945156
N-(3-cyclopentylsulfonylphenyl)-2,4,6-trimethylbenzenesulfonamide (PubChem CID 38945156) has the molecular formula C20H25NO4S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-(3-cyclopentylsulfonylphenyl)-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-(3-cyclopentylsulfonylphenyl)-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 38945156 |
| Molecular Formula | C20H25NO4S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-(3-cyclopentylsulfonylphenyl)-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2cccc(S(=O)(=O)C3CCCC3)c2)c(C)c1 |
| InChI | InChI=1S/C20H25NO4S2/c1-14-11-15(2)20(16(3)12-14)27(24,25)21-17-7-6-10-19(13-17)26(22,23)18-8-4-5-9-18/h6-7,10-13,18,21H,4-5,8-9H2,1-3H3 |
| InChIKey | XZYKNWUNHUCNBL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |