C26H31NO5 — CID 10252546
6-[2-(1,3-benzodioxol-5-yl)ethyl]-6-propan-2-yl-3-(N-propylanilino)oxane-2,4-dione (PubChem CID 10252546) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 6-[2-(1,3-benzodioxol-5-yl)ethyl]-6-propan-2-yl-3-(N-propylanilino)oxane-2,4-dione.
| Compound Name | 6-[2-(1,3-benzodioxol-5-yl)ethyl]-6-propan-2-yl-3-(N-propylanilino)oxane-2,4-dione |
|---|---|
| PubChem CID | 10252546 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 6-[2-(1,3-benzodioxol-5-yl)ethyl]-6-propan-2-yl-3-(N-propylanilino)oxane-2,4-dione |
| SMILES | CCCN(c1ccccc1)C1C(=O)CC(CCc2ccc3c(c2)OCO3)(C(C)C)OC1=O |
| InChI | InChI=1S/C26H31NO5/c1-4-14-27(20-8-6-5-7-9-20)24-21(28)16-26(18(2)3,32-25(24)29)13-12-19-10-11-22-23(15-19)31-17-30-22/h5-11,15,18,24H,4,12-14,16-17H2,1-3H3 |
| InChIKey | HOXMLWJCEWIWSP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|