C21H29NO2 — CID 171532305
2-(1,3-benzodioxol-5-yl)-N-benzyl-N-methylethanamine;ethane;ethene (PubChem CID 171532305) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-benzyl-N-methylethanamine;ethane;ethene.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-benzyl-N-methylethanamine;ethane;ethene |
|---|---|
| PubChem CID | 171532305 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-benzyl-N-methylethanamine;ethane;ethene |
| SMILES | C=C.CC.CN(CCc1ccc2c(c1)OCO2)Cc1ccccc1 |
| InChI | InChI=1S/C17H19NO2.C2H6.C2H4/c1-18(12-15-5-3-2-4-6-15)10-9-14-7-8-16-17(11-14)20-13-19-16;2*1-2/h2-8,11H,9-10,12-13H2,1H3;1-2H3;1-2H2 |
| InChIKey | PQYVLLCGWQDFTC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|