C12H17NO3 — CID 115258994
2-(1,3-benzodioxol-5-yl)-N-(methoxymethyl)-N-methylethanamine (PubChem CID 115258994) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-(methoxymethyl)-N-methylethanamine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-(methoxymethyl)-N-methylethanamine |
|---|---|
| PubChem CID | 115258994 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-(methoxymethyl)-N-methylethanamine |
| SMILES | COCN(C)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H17NO3/c1-13(8-14-2)6-5-10-3-4-11-12(7-10)16-9-15-11/h3-4,7H,5-6,8-9H2,1-2H3 |
| InChIKey | NZVPRNUKMCQVRB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|