C28H30N2O3 — CID 90748293
6-[2-(4-aminophenyl)ethyl]-6-phenyl-3-(N-propylanilino)oxane-2,4-dione (PubChem CID 90748293) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 6-[2-(4-aminophenyl)ethyl]-6-phenyl-3-(N-propylanilino)oxane-2,4-dione.
| Compound Name | 6-[2-(4-aminophenyl)ethyl]-6-phenyl-3-(N-propylanilino)oxane-2,4-dione |
|---|---|
| PubChem CID | 90748293 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 6-[2-(4-aminophenyl)ethyl]-6-phenyl-3-(N-propylanilino)oxane-2,4-dione |
| SMILES | CCCN(c1ccccc1)C1C(=O)CC(CCc2ccc(N)cc2)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C28H30N2O3/c1-2-19-30(24-11-7-4-8-12-24)26-25(31)20-28(33-27(26)32,22-9-5-3-6-10-22)18-17-21-13-15-23(29)16-14-21/h3-16,26H,2,17-20,29H2,1H3 |
| InChIKey | WZPOCBCUTABNFL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|