C28H27NO4 — CID 10343248
3-(3,4-dihydro-2H-quinolin-1-yl)-6-[2-(4-hydroxyphenyl)ethyl]-6-phenyloxane-2,4-dione (PubChem CID 10343248) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-yl)-6-[2-(4-hydroxyphenyl)ethyl]-6-phenyloxane-2,4-dione.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-6-[2-(4-hydroxyphenyl)ethyl]-6-phenyloxane-2,4-dione |
|---|---|
| PubChem CID | 10343248 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-6-[2-(4-hydroxyphenyl)ethyl]-6-phenyloxane-2,4-dione |
| SMILES | O=C1CC(CCc2ccc(O)cc2)(c2ccccc2)OC(=O)C1N1CCCc2ccccc21 |
| InChI | InChI=1S/C28H27NO4/c30-23-14-12-20(13-15-23)16-17-28(22-9-2-1-3-10-22)19-25(31)26(27(32)33-28)29-18-6-8-21-7-4-5-11-24(21)29/h1-5,7,9-15,26,30H,6,8,16-19H2 |
| InChIKey | WJKFGMSJNKABKR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|