C27H28ClN3O4S — CID 91292237
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione (PubChem CID 91292237) has the molecular formula C27H28ClN3O4S and a molecular weight of 526.06 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91292237 |
| Molecular Formula | C27H28ClN3O4S |
| Molecular Weight | 526.06 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Sc3nncn3-c3ccccc3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C27H28ClN3O4S/c1-34-23-12-11-18(15-21(23)28)13-14-27(19-7-5-6-8-19)16-22(32)24(25(33)35-27)36-26-30-29-17-31(26)20-9-3-2-4-10-20/h2-4,9-12,15,17,19,24H,5-8,13-14,16H2,1H3 |
| InChIKey | PHDYNTZLEBNLSJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.06 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|