C20H28O4 — CID 142827997
6-cyclopentyl-6-ethyloxane-2,4-dione;(2-methylphenyl)methanol (PubChem CID 142827997) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 6-cyclopentyl-6-ethyloxane-2,4-dione;(2-methylphenyl)methanol.
| Compound Name | 6-cyclopentyl-6-ethyloxane-2,4-dione;(2-methylphenyl)methanol |
|---|---|
| PubChem CID | 142827997 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 6-cyclopentyl-6-ethyloxane-2,4-dione;(2-methylphenyl)methanol |
| SMILES | CCC1(C2CCCC2)CC(=O)CC(=O)O1.Cc1ccccc1CO |
| InChI | InChI=1S/C12H18O3.C8H10O/c1-2-12(9-5-3-4-6-9)8-10(13)7-11(14)15-12;1-7-4-2-3-5-8(7)6-9/h9H,2-8H2,1H3;2-5,9H,6H2,1H3 |
| InChIKey | RMOZFFOVMXOUHP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|