C22H28O6 — CID 16728838
3-acetyl-6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]oxane-2,4-dione (PubChem CID 16728838) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 3-acetyl-6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]oxane-2,4-dione.
| Compound Name | 3-acetyl-6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 16728838 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-acetyl-6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(C(C)=O)C(=O)O2)c(OC)c1 |
| InChI | InChI=1S/C22H28O6/c1-14(23)20-18(24)13-22(28-21(20)25,16-6-4-5-7-16)11-10-15-8-9-17(26-2)12-19(15)27-3/h8-9,12,16,20H,4-7,10-11,13H2,1-3H3 |
| InChIKey | SMOZQNMAQVHBBE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|