C27H32N4O5 — CID 91319469
6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione (PubChem CID 91319469) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91319469 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4ncc(C)cn4n3)C(=O)O2)c(OC)c1 |
| InChI | InChI=1S/C27H32N4O5/c1-17-15-28-26-29-24(30-31(26)16-17)13-21-22(32)14-27(36-25(21)33,19-6-4-5-7-19)11-10-18-8-9-20(34-2)12-23(18)35-3/h8-9,12,15-16,19,21H,4-7,10-11,13-14H2,1-3H3 |
| InChIKey | QPTHRCNVJRMROL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 104.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|