C18H18O — CID 65407423
1-(2,3-dihydro-1H-inden-1-yl)-2-(2-methylphenyl)ethanone (PubChem CID 65407423) has the molecular formula C18H18O and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)-2-(2-methylphenyl)ethanone.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)-2-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 65407423 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)-2-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1CC(=O)C1CCc2ccccc21 |
| InChI | InChI=1S/C18H18O/c1-13-6-2-3-8-15(13)12-18(19)17-11-10-14-7-4-5-9-16(14)17/h2-9,17H,10-12H2,1H3 |
| InChIKey | QCDMMNZPWFOCPC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |