C21H20N2O3 — CID 98359261
(2R)-2-cyano-4-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-methoxyphenyl)-3-oxobutanamide (PubChem CID 98359261) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (2R)-2-cyano-4-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-methoxyphenyl)-3-oxobutanamide.
| Compound Name | (2R)-2-cyano-4-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-methoxyphenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 98359261 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (2R)-2-cyano-4-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-methoxyphenyl)-3-oxobutanamide |
| SMILES | COc1ccc(NC(=O)[C@H](C#N)C(=O)C[C@H]2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C21H20N2O3/c1-26-17-10-8-16(9-11-17)23-21(25)19(13-22)20(24)12-15-7-6-14-4-2-3-5-18(14)15/h2-5,8-11,15,19H,6-7,12H2,1H3,(H,23,25)/t15-,19-/m1/s1 |
| InChIKey | VSFSLXWXORNDSR-DNVCBOLYSA-N |
| XLogP | 3.46 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|