C17H11F3N2O3 — CID 98142107
(2R)-2-cyano-N-(4-methoxyphenyl)-3-oxo-3-(3,4,5-trifluorophenyl)propanamide (PubChem CID 98142107) has the molecular formula C17H11F3N2O3 and a molecular weight of 348.28 g/mol. Its IUPAC name is (2R)-2-cyano-N-(4-methoxyphenyl)-3-oxo-3-(3,4,5-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-cyano-N-(4-methoxyphenyl)-3-oxo-3-(3,4,5-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 98142107 |
| Molecular Formula | C17H11F3N2O3 |
| Molecular Weight | 348.28 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (2R)-2-cyano-N-(4-methoxyphenyl)-3-oxo-3-(3,4,5-trifluorophenyl)propanamide |
| SMILES | COc1ccc(NC(=O)[C@H](C#N)C(=O)c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H11F3N2O3/c1-25-11-4-2-10(3-5-11)22-17(24)12(8-21)16(23)9-6-13(18)15(20)14(19)7-9/h2-7,12H,1H3,(H,22,24)/t12-/m1/s1 |
| InChIKey | WYPYSFRJGXDFKC-GFCCVEGCSA-N |
| XLogP | 3.07 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|