C20H19ClN4O4 — CID 166183942
3-(2-chloro-6-morpholin-4-yl-4-pyridinyl)-2-cyano-N-(4-methoxyphenyl)-3-oxopropanamide (PubChem CID 166183942) has the molecular formula C20H19ClN4O4 and a molecular weight of 414.85 g/mol. Its IUPAC name is 3-(2-chloro-6-morpholin-4-yl-4-pyridinyl)-2-cyano-N-(4-methoxyphenyl)-3-oxopropanamide.
| Compound Name | 3-(2-chloro-6-morpholin-4-yl-4-pyridinyl)-2-cyano-N-(4-methoxyphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 166183942 |
| Molecular Formula | C20H19ClN4O4 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 3-(2-chloro-6-morpholin-4-yl-4-pyridinyl)-2-cyano-N-(4-methoxyphenyl)-3-oxopropanamide |
| SMILES | COc1ccc(NC(=O)C(C#N)C(=O)c2cc(Cl)nc(N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C20H19ClN4O4/c1-28-15-4-2-14(3-5-15)23-20(27)16(12-22)19(26)13-10-17(21)24-18(11-13)25-6-8-29-9-7-25/h2-5,10-11,16H,6-9H2,1H3,(H,23,27) |
| InChIKey | GZEWMNZMMHSHKZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|