C18H15FN2O — CID 86955794
N-(3-cyano-4-fluorophenyl)-2-(2,3-dihydro-1H-inden-1-yl)acetamide (PubChem CID 86955794) has the molecular formula C18H15FN2O and a molecular weight of 294.33 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-2-(2,3-dihydro-1H-inden-1-yl)acetamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-2-(2,3-dihydro-1H-inden-1-yl)acetamide |
|---|---|
| PubChem CID | 86955794 |
| Molecular Formula | C18H15FN2O |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-2-(2,3-dihydro-1H-inden-1-yl)acetamide |
| SMILES | N#Cc1cc(NC(=O)CC2CCc3ccccc32)ccc1F |
| InChI | InChI=1S/C18H15FN2O/c19-17-8-7-15(9-14(17)11-20)21-18(22)10-13-6-5-12-3-1-2-4-16(12)13/h1-4,7-9,13H,5-6,10H2,(H,21,22) |
| InChIKey | LWBCTLDQVWPOFD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |