C21H23ClN2O2 — CID 86957312
N-(4-chlorophenyl)-4-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]butanamide (PubChem CID 86957312) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]butanamide.
| Compound Name | N-(4-chlorophenyl)-4-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 86957312 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(4-chlorophenyl)-4-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]butanamide |
| SMILES | O=C(CC1CCc2ccccc21)NCCCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23ClN2O2/c22-17-9-11-18(12-10-17)24-20(25)6-3-13-23-21(26)14-16-8-7-15-4-1-2-5-19(15)16/h1-2,4-5,9-12,16H,3,6-8,13-14H2,(H,23,26)(H,24,25) |
| InChIKey | BIQCKTJDZMJDFY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|