C20H22FNO — CID 86955855
2-(2,3-dihydro-1H-inden-1-yl)-N-[3-(3-fluorophenyl)propyl]acetamide (PubChem CID 86955855) has the molecular formula C20H22FNO and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-yl)-N-[3-(3-fluorophenyl)propyl]acetamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-yl)-N-[3-(3-fluorophenyl)propyl]acetamide |
|---|---|
| PubChem CID | 86955855 |
| Molecular Formula | C20H22FNO |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-yl)-N-[3-(3-fluorophenyl)propyl]acetamide |
| SMILES | O=C(CC1CCc2ccccc21)NCCCc1cccc(F)c1 |
| InChI | InChI=1S/C20H22FNO/c21-18-8-3-5-15(13-18)6-4-12-22-20(23)14-17-11-10-16-7-1-2-9-19(16)17/h1-3,5,7-9,13,17H,4,6,10-12,14H2,(H,22,23) |
| InChIKey | MDCVSCKVEHGUCX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|