C21H20N2O3 — CID 98529487
(Z,2R)-2-cyano-N-(4-methoxyphenyl)-3-oxo-7-phenylhept-6-enamide (PubChem CID 98529487) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (Z,2R)-2-cyano-N-(4-methoxyphenyl)-3-oxo-7-phenylhept-6-enamide.
| Compound Name | (Z,2R)-2-cyano-N-(4-methoxyphenyl)-3-oxo-7-phenylhept-6-enamide |
|---|---|
| PubChem CID | 98529487 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (Z,2R)-2-cyano-N-(4-methoxyphenyl)-3-oxo-7-phenylhept-6-enamide |
| SMILES | COc1ccc(NC(=O)[C@H](C#N)C(=O)CC/C=C\c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O3/c1-26-18-13-11-17(12-14-18)23-21(25)19(15-22)20(24)10-6-5-9-16-7-3-2-4-8-16/h2-5,7-9,11-14,19H,6,10H2,1H3,(H,23,25)/b9-5-/t19-/m1/s1 |
| InChIKey | SVGATCIHIJEKKZ-FVXMCEBTSA-N |
| XLogP | 3.84 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|