C52H60N4O8 — CID 101249884
[(1S)-2,3-dihydro-1H-inden-1-yl] 2-[4,7,10-tris[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 101249884) has the molecular formula C52H60N4O8 and a molecular weight of 869.07 g/mol. Its IUPAC name is [(1S)-2,3-dihydro-1H-inden-1-yl] 2-[4,7,10-tris[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | [(1S)-2,3-dihydro-1H-inden-1-yl] 2-[4,7,10-tris[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 101249884 |
| Molecular Formula | C52H60N4O8 |
| Molecular Weight | 869.07 g/mol |
| Exact Mass | 868.44 |
| IUPAC Name | [(1S)-2,3-dihydro-1H-inden-1-yl] 2-[4,7,10-tris[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | O=C(CN1CCN(CC(=O)O[C@H]2CCc3ccccc32)CCN(CC(=O)O[C@H]2CCc3ccccc32)CCN(CC(=O)O[C@H]2CCc3ccccc32)CC1)O[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C52H60N4O8/c57-49(61-45-21-17-37-9-1-5-13-41(37)45)33-53-25-27-54(34-50(58)62-46-22-18-38-10-2-6-14-42(38)46)29-31-56(36-52(60)64-48-24-20-40-12-4-8-16-44(40)48)32-30-55(28-26-53)35-51(59)63-47-23-19-39-11-3-7-15-43(39)47/h1-16,45-48H,17-36H2/t45-,46-,47-,48-/m0/s1 |
| InChIKey | OBKLUBWWUWLQLY-KVXOYYPDSA-N |
| XLogP | 6.13 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.07 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|