C13H14O6 — CID 102059267
(2R,3R)-2-(2,3-dihydro-1H-inden-1-yloxy)-3-hydroxybutanedioic acid (PubChem CID 102059267) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is (2R,3R)-2-(2,3-dihydro-1H-inden-1-yloxy)-3-hydroxybutanedioic acid.
| Compound Name | (2R,3R)-2-(2,3-dihydro-1H-inden-1-yloxy)-3-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 102059267 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (2R,3R)-2-(2,3-dihydro-1H-inden-1-yloxy)-3-hydroxybutanedioic acid |
| SMILES | O=C(O)[C@H](O)[C@@H](OC1CCc2ccccc21)C(=O)O |
| InChI | InChI=1S/C13H14O6/c14-10(12(15)16)11(13(17)18)19-9-6-5-7-3-1-2-4-8(7)9/h1-4,9-11,14H,5-6H2,(H,15,16)(H,17,18)/t9?,10-,11-/m1/s1 |
| InChIKey | JFCMPHAUOFDDRO-FHZGLPGMSA-N |
| XLogP | 0.59 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |