C14H17O- — CID 163573761
1-pent-4-en-2-yloxy-2,3-dihydro-1H-indene (PubChem CID 163573761) has the molecular formula C14H17O- and a molecular weight of 201.29 g/mol. Its IUPAC name is 1-pent-4-en-2-yloxy-2,3-dihydro-1H-indene.
| Compound Name | 1-pent-4-en-2-yloxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 163573761 |
| Molecular Formula | C14H17O- |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 1-pent-4-en-2-yloxy-2,3-dihydro-1H-indene |
| SMILES | C=C[CH-]C(C)OC1CCc2ccccc21 |
| InChI | InChI=1S/C14H17O/c1-3-6-11(2)15-14-10-9-12-7-4-5-8-13(12)14/h3-8,11,14H,1,9-10H2,2H3/q-1 |
| InChIKey | GBQJPDKCNXKHIC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|